C22H35N5O6 — CID 18913801
4-(4-aminophenyl)-2-[4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid (PubChem CID 18913801) has the molecular formula C22H35N5O6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2-[4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid.
| Compound Name | 4-(4-aminophenyl)-2-[4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
|---|---|
| PubChem CID | 18913801 |
| Molecular Formula | C22H35N5O6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 4-(4-aminophenyl)-2-[4,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
| SMILES | Nc1ccc(CCC(C(=O)O)N2CCN(CC(=O)O)CCNCCN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C22H35N5O6/c23-18-4-1-17(2-5-18)3-6-19(22(32)33)27-13-11-25(15-20(28)29)9-7-24-8-10-26(12-14-27)16-21(30)31/h1-2,4-5,19,24H,3,6-16,23H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | RPJYTPMCUAIOHN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|