C25H33N5O6 — CID 58455067
4-(4-aminophenyl)-2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]butanoic acid (PubChem CID 58455067) has the molecular formula C25H33N5O6 and a molecular weight of 499.57 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]butanoic acid.
| Compound Name | 4-(4-aminophenyl)-2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]butanoic acid |
|---|---|
| PubChem CID | 58455067 |
| Molecular Formula | C25H33N5O6 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 4-(4-aminophenyl)-2-[3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]butanoic acid |
| SMILES | Nc1ccc(CCC(C(=O)O)N2CCN(CC(=O)O)Cc3cccc(n3)CN(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C25H33N5O6/c26-19-7-4-18(5-8-19)6-9-22(25(35)36)30-12-10-28(16-23(31)32)14-20-2-1-3-21(27-20)15-29(11-13-30)17-24(33)34/h1-5,7-8,22H,6,9-17,26H2,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | XRJPVMYRCKQEFS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|