C19H30N4O5 — CID 166074887
2-[9-(carboxymethyl)-6-(2-oxoethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid;ethane (PubChem CID 166074887) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[9-(carboxymethyl)-6-(2-oxoethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid;ethane.
| Compound Name | 2-[9-(carboxymethyl)-6-(2-oxoethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 166074887 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[9-(carboxymethyl)-6-(2-oxoethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid;ethane |
| SMILES | CC.O=CCN1CCN(CC(=O)O)Cc2cccc(n2)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H24N4O5.C2H6/c22-9-8-19-4-6-20(12-16(23)24)10-14-2-1-3-15(18-14)11-21(7-5-19)13-17(25)26;1-2/h1-3,9H,4-8,10-13H2,(H,23,24)(H,25,26);1-2H3 |
| InChIKey | RMCVATJNAUJJBA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|