C17H21N4O6Tm — CID 46241613
2-[3,9-bis(carboxylatomethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate;thulium(3+) (PubChem CID 46241613) has the molecular formula C17H21N4O6Tm and a molecular weight of 546.31 g/mol. Its IUPAC name is 2-[3,9-bis(carboxylatomethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate;thulium(3+).
| Compound Name | 2-[3,9-bis(carboxylatomethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate;thulium(3+) |
|---|---|
| PubChem CID | 46241613 |
| Molecular Formula | C17H21N4O6Tm |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 2-[3,9-bis(carboxylatomethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl]acetate;thulium(3+) |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])Cc2cccc(n2)CN(CC(=O)[O-])CC1.[Tm+3] |
| InChI | InChI=1S/C17H24N4O6.Tm/c22-15(23)10-19-4-6-20(11-16(24)25)8-13-2-1-3-14(18-13)9-21(7-5-19)12-17(26)27;/h1-3H,4-12H2,(H,22,23)(H,24,25)(H,26,27);/q;+3/p-3 |
| InChIKey | KTAOZZYSPVTTCI-UHFFFAOYSA-K |
| XLogP | -4.75 |
| TPSA | 143.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |