C21H27GdN4O6 — CID 140538694
2-[3,10-bis(carboxylatomethyl)-3,10,13,19-tetrazatricyclo[13.3.1.04,9]nonadeca-1(18),15(19),16-trien-13-yl]acetate;gadolinium(3+) (PubChem CID 140538694) has the molecular formula C21H27GdN4O6 and a molecular weight of 588.72 g/mol. Its IUPAC name is 2-[3,10-bis(carboxylatomethyl)-3,10,13,19-tetrazatricyclo[13.3.1.04,9]nonadeca-1(18),15(19),16-trien-13-yl]acetate;gadolinium(3+).
| Compound Name | 2-[3,10-bis(carboxylatomethyl)-3,10,13,19-tetrazatricyclo[13.3.1.04,9]nonadeca-1(18),15(19),16-trien-13-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 140538694 |
| Molecular Formula | C21H27GdN4O6 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 2-[3,10-bis(carboxylatomethyl)-3,10,13,19-tetrazatricyclo[13.3.1.04,9]nonadeca-1(18),15(19),16-trien-13-yl]acetate;gadolinium(3+) |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])C2CCCCC2N(CC(=O)[O-])Cc2cccc(n2)C1.[Gd+3] |
| InChI | InChI=1S/C21H30N4O6.Gd/c26-19(27)12-23-8-9-24(13-20(28)29)17-6-1-2-7-18(17)25(14-21(30)31)11-16-5-3-4-15(10-23)22-16;/h3-5,17-18H,1-2,6-14H2,(H,26,27)(H,28,29)(H,30,31);/q;+3/p-3 |
| InChIKey | HEVMASCAPLRVOX-UHFFFAOYSA-K |
| XLogP | -3.44 |
| TPSA | 143.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |