C27H37N5O6 — CID 176637978
2-[3,9-bis(carboxymethyl)-4-[[4-(propan-2-ylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid (PubChem CID 176637978) has the molecular formula C27H37N5O6 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[3,9-bis(carboxymethyl)-4-[[4-(propan-2-ylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid.
| Compound Name | 2-[3,9-bis(carboxymethyl)-4-[[4-(propan-2-ylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 176637978 |
| Molecular Formula | C27H37N5O6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 2-[3,9-bis(carboxymethyl)-4-[[4-(propan-2-ylamino)phenyl]methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(14),11(15),12-trien-6-yl]acetic acid |
| SMILES | CC(C)Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)Cc3cccc(n3)CN2CC(=O)O)cc1 |
| InChI | InChI=1S/C27H37N5O6/c1-19(2)28-21-8-6-20(7-9-21)12-24-15-31(17-26(35)36)11-10-30(16-25(33)34)13-22-4-3-5-23(29-22)14-32(24)18-27(37)38/h3-9,19,24,28H,10-18H2,1-2H3,(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | IYQDAFKEGVNTIB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |