C45H70N10O12S2 — CID 160633198
bis(2-[4,7-bis(carboxymethyl)-5-[[4-(ethylcarbamothioylamino)phenyl]methyl]-1,4,7-triazonan-1-yl]acetic acid);methane (PubChem CID 160633198) has the molecular formula C45H70N10O12S2 and a molecular weight of 1007.25 g/mol. Its IUPAC name is bis(2-[4,7-bis(carboxymethyl)-5-[[4-(ethylcarbamothioylamino)phenyl]methyl]-1,4,7-triazonan-1-yl]acetic acid);methane.
| Compound Name | bis(2-[4,7-bis(carboxymethyl)-5-[[4-(ethylcarbamothioylamino)phenyl]methyl]-1,4,7-triazonan-1-yl]acetic acid);methane |
|---|---|
| PubChem CID | 160633198 |
| Molecular Formula | C45H70N10O12S2 |
| Molecular Weight | 1007.25 g/mol |
| Exact Mass | 1006.46 |
| IUPAC Name | bis(2-[4,7-bis(carboxymethyl)-5-[[4-(ethylcarbamothioylamino)phenyl]methyl]-1,4,7-triazonan-1-yl]acetic acid);methane |
| SMILES | C.CCNC(=S)Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCN2CC(=O)O)cc1.CCNC(=S)Nc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCN2CC(=O)O)cc1 |
| InChI | InChI=1S/2C22H33N5O6S.CH4/c2*1-2-23-22(34)24-17-5-3-16(4-6-17)11-18-12-26(14-20(30)31)8-7-25(13-19(28)29)9-10-27(18)15-21(32)33;/h2*3-6,18H,2,7-15H2,1H3,(H,28,29)(H,30,31)(H,32,33)(H2,23,24,34);1H4 |
| InChIKey | RIENRRMFMFGBRZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 291.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|