C20H33N5O4S — CID 59871989
2-[3-[[4-(ethylcarbamothioylamino)phenyl]methyl]-4,7-bis(hydroxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 59871989) has the molecular formula C20H33N5O4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[3-[[4-(ethylcarbamothioylamino)phenyl]methyl]-4,7-bis(hydroxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[3-[[4-(ethylcarbamothioylamino)phenyl]methyl]-4,7-bis(hydroxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 59871989 |
| Molecular Formula | C20H33N5O4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-[3-[[4-(ethylcarbamothioylamino)phenyl]methyl]-4,7-bis(hydroxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | CCNC(=S)Nc1ccc(CC2CN(CC(=O)O)CCN(CO)CCN2CO)cc1 |
| InChI | InChI=1S/C20H33N5O4S/c1-2-21-20(30)22-17-5-3-16(4-6-17)11-18-12-24(13-19(28)29)8-7-23(14-26)9-10-25(18)15-27/h3-6,18,26-27H,2,7-15H2,1H3,(H,28,29)(H2,21,22,30) |
| InChIKey | ZLNOBZVDDMRIGO-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|