C32H50N6O7S — CID 167140825
2-[7,10-bis(carboxymethyl)-6-[[4-(cyclooctylcarbamothioylamino)phenyl]methyl]-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 167140825) has the molecular formula C32H50N6O7S and a molecular weight of 662.85 g/mol. Its IUPAC name is 2-[7,10-bis(carboxymethyl)-6-[[4-(cyclooctylcarbamothioylamino)phenyl]methyl]-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7,10-bis(carboxymethyl)-6-[[4-(cyclooctylcarbamothioylamino)phenyl]methyl]-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 167140825 |
| Molecular Formula | C32H50N6O7S |
| Molecular Weight | 662.85 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | 2-[7,10-bis(carboxymethyl)-6-[[4-(cyclooctylcarbamothioylamino)phenyl]methyl]-4-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=CCN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)C(Cc2ccc(NC(=S)NC3CCCCCCC3)cc2)C1 |
| InChI | InChI=1S/C32H50N6O7S/c39-19-18-37-15-14-35(22-29(40)41)12-13-36(23-30(42)43)16-17-38(24-31(44)45)28(21-37)20-25-8-10-27(11-9-25)34-32(46)33-26-6-4-2-1-3-5-7-26/h8-11,19,26,28H,1-7,12-18,20-24H2,(H,40,41)(H,42,43)(H,44,45)(H2,33,34,46) |
| InChIKey | MCUYSOSTSHHYDV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.85 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|