C26H39N5O9 — CID 142926853
acetic acid;2-[4,7-bis(carboxymethyl)-5-[[4-(prop-2-enoylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 142926853) has the molecular formula C26H39N5O9 and a molecular weight of 565.62 g/mol. Its IUPAC name is acetic acid;2-[4,7-bis(carboxymethyl)-5-[[4-(prop-2-enoylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | acetic acid;2-[4,7-bis(carboxymethyl)-5-[[4-(prop-2-enoylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 142926853 |
| Molecular Formula | C26H39N5O9 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | acetic acid;2-[4,7-bis(carboxymethyl)-5-[[4-(prop-2-enoylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | C=CC(=O)Nc1ccc(CC2CN(CC(=O)O)CCNCCN(CC(=O)O)CCN2CC(=O)O)cc1.CC(=O)O |
| InChI | InChI=1S/C24H35N5O7.C2H4O2/c1-2-21(30)26-19-5-3-18(4-6-19)13-20-14-28(16-23(33)34)10-8-25-7-9-27(15-22(31)32)11-12-29(20)17-24(35)36;1-2(3)4/h2-6,20,25H,1,7-17H2,(H,26,30)(H,31,32)(H,33,34)(H,35,36);1H3,(H,3,4) |
| InChIKey | RQUGMACDFAWWGB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 200.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|