C32H41N5O11 — CID 153375234
2-[4,7,10-tris(carboxymethyl)-6-[[4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 153375234) has the molecular formula C32H41N5O11 and a molecular weight of 671.70 g/mol. Its IUPAC name is 2-[4,7,10-tris(carboxymethyl)-6-[[4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10-tris(carboxymethyl)-6-[[4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 153375234 |
| Molecular Formula | C32H41N5O11 |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.28 |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-6-[[4-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]phenyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)C(Cc2ccc(NC(=O)/C=C/c3ccc(O)c(O)c3)cc2)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C32H41N5O11/c38-26-7-3-23(16-27(26)39)4-8-28(40)33-24-5-1-22(2-6-24)15-25-17-36(20-31(45)46)12-11-34(18-29(41)42)9-10-35(19-30(43)44)13-14-37(25)21-32(47)48/h1-8,16,25,38-39H,9-15,17-21H2,(H,33,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48)/b8-4+ |
| InChIKey | YXJXBAYPTKYCKH-XBXARRHUSA-N |
| XLogP | 0.22 |
| TPSA | 231.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|