C21H21NO5 — CID 4973834
2-hydroxy-5-[3-[4-(oxolan-2-ylmethyl)phenyl]prop-2-enoylamino]benzoic acid (PubChem CID 4973834) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-hydroxy-5-[3-[4-(oxolan-2-ylmethyl)phenyl]prop-2-enoylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-[4-(oxolan-2-ylmethyl)phenyl]prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 4973834 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-hydroxy-5-[3-[4-(oxolan-2-ylmethyl)phenyl]prop-2-enoylamino]benzoic acid |
| SMILES | O=C(C=Cc1ccc(CC2CCCO2)cc1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H21NO5/c23-19-9-8-16(13-18(19)21(25)26)22-20(24)10-7-14-3-5-15(6-4-14)12-17-2-1-11-27-17/h3-10,13,17,23H,1-2,11-12H2,(H,22,24)(H,25,26) |
| InChIKey | OLOXSTLKTZVTPM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|