C29H39N3O3 — CID 42882344
N-[[2-(dimethylamino)-5-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]-3,3-dimethyl-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 42882344) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]-3,3-dimethyl-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | N-[[2-(dimethylamino)-5-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]-3,3-dimethyl-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 42882344 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | N-[[2-(dimethylamino)-5-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]-3,3-dimethyl-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | CN(C)c1ccc(NC(=O)/C=C/c2ccccc2)cc1CN(CC1CCCO1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C29H39N3O3/c1-29(2,3)19-28(34)32(21-25-12-9-17-35-25)20-23-18-24(14-15-26(23)31(4)5)30-27(33)16-13-22-10-7-6-8-11-22/h6-8,10-11,13-16,18,25H,9,12,17,19-21H2,1-5H3,(H,30,33)/b16-13+ |
| InChIKey | PXCRCHWKFLWFIZ-DTQAZKPQSA-N |
| XLogP | 5.35 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|