C21H27N3O4 — CID 46138386
N-[3-[[acetyl(oxolan-2-ylmethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide (PubChem CID 46138386) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[3-[[acetyl(oxolan-2-ylmethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[acetyl(oxolan-2-ylmethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46138386 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[3-[[acetyl(oxolan-2-ylmethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide |
| SMILES | CC(=O)N(Cc1cc(NC(=O)c2ccco2)ccc1N(C)C)CC1CCCO1 |
| InChI | InChI=1S/C21H27N3O4/c1-15(25)24(14-18-6-4-10-27-18)13-16-12-17(8-9-19(16)23(2)3)22-21(26)20-7-5-11-28-20/h5,7-9,11-12,18H,4,6,10,13-14H2,1-3H3,(H,22,26) |
| InChIKey | PCLVFQRFSAFTNS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|