C27H36ClN3O3 — CID 93128725
2-chloro-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 93128725) has the molecular formula C27H36ClN3O3 and a molecular weight of 486.06 g/mol. Its IUPAC name is 2-chloro-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 93128725 |
| Molecular Formula | C27H36ClN3O3 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2-chloro-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)CC(C)(C)C)cc1CN(C[C@H]1CCCO1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C27H36ClN3O3/c1-27(2,3)16-25(32)29-20-12-13-24(30(4)5)19(15-20)17-31(18-21-9-8-14-34-21)26(33)22-10-6-7-11-23(22)28/h6-7,10-13,15,21H,8-9,14,16-18H2,1-5H3,(H,29,32)/t21-/m1/s1 |
| InChIKey | DDQYFVLCBSMANJ-OAQYLSRUSA-N |
| XLogP | 5.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|