C27H37N3O3 — CID 46138736
N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-4-methoxybenzamide (PubChem CID 46138736) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-4-methoxybenzamide.
| Compound Name | N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46138736 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(Cc2cc(NC(=O)CC(C)(C)C)ccc2N(C)C)CC2CC2)cc1 |
| InChI | InChI=1S/C27H37N3O3/c1-27(2,3)16-25(31)28-22-11-14-24(29(4)5)21(15-22)18-30(17-19-7-8-19)26(32)20-9-12-23(33-6)13-10-20/h9-15,19H,7-8,16-18H2,1-6H3,(H,28,31) |
| InChIKey | RGBZISFZJZZISB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|