C26H43N3O3 — CID 93019493
N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl]hexanamide (PubChem CID 93019493) has the molecular formula C26H43N3O3 and a molecular weight of 445.65 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl]hexanamide.
| Compound Name | N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 93019493 |
| Molecular Formula | C26H43N3O3 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(N(C)C)c(CN(C[C@@H]2CCCO2)C(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C26H43N3O3/c1-7-8-9-12-24(30)27-21-13-14-23(28(5)6)20(16-21)18-29(19-22-11-10-15-32-22)25(31)17-26(2,3)4/h13-14,16,22H,7-12,15,17-19H2,1-6H3,(H,27,30)/t22-/m0/s1 |
| InChIKey | PUOGWBYHOHDSMN-QFIPXVFZSA-N |
| XLogP | 5.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|