C28H39N3O3 — CID 93128683
N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 93128683) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 93128683 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-[[2-(dimethylamino)-5-(3,3-dimethylbutanoylamino)phenyl]methyl]-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | Cc1cccc(C(=O)N(Cc2cc(NC(=O)CC(C)(C)C)ccc2N(C)C)C[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C28H39N3O3/c1-20-9-7-10-21(15-20)27(33)31(19-24-11-8-14-34-24)18-22-16-23(12-13-25(22)30(5)6)29-26(32)17-28(2,3)4/h7,9-10,12-13,15-16,24H,8,11,14,17-19H2,1-6H3,(H,29,32)/t24-/m1/s1 |
| InChIKey | BNHCLNQDUGBJSM-XMMPIXPASA-N |
| XLogP | 5.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|