C27H37N3O3 — CID 42882334
N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl(oxolan-2-ylmethyl)amino]methyl]phenyl]benzamide (PubChem CID 42882334) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl(oxolan-2-ylmethyl)amino]methyl]phenyl]benzamide.
| Compound Name | N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl(oxolan-2-ylmethyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 42882334 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[3,3-dimethylbutanoyl(oxolan-2-ylmethyl)amino]methyl]phenyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccccc2)cc1CN(CC1CCCO1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C27H37N3O3/c1-27(2,3)17-25(31)30(19-23-12-9-15-33-23)18-21-16-22(13-14-24(21)29(4)5)28-26(32)20-10-7-6-8-11-20/h6-8,10-11,13-14,16,23H,9,12,15,17-19H2,1-5H3,(H,28,32) |
| InChIKey | GLRFXRJTPLMVAG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|