C27H31N3O4S — CID 46111147
N-[[2-(dimethylamino)-5-[(2-methoxybenzoyl)amino]phenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 46111147) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-[(2-methoxybenzoyl)amino]phenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-[[2-(dimethylamino)-5-[(2-methoxybenzoyl)amino]phenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46111147 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-[[2-(dimethylamino)-5-[(2-methoxybenzoyl)amino]phenyl]methyl]-N-(oxolan-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(N(C)C)c(CN(CC2CCCO2)C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C27H31N3O4S/c1-29(2)23-13-12-20(28-26(31)22-9-4-5-10-24(22)33-3)16-19(23)17-30(18-21-8-6-14-34-21)27(32)25-11-7-15-35-25/h4-5,7,9-13,15-16,21H,6,8,14,17-18H2,1-3H3,(H,28,31) |
| InChIKey | DFUALKTZEXADAQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|