C27H37N3O4 — CID 93128807
(2R)-N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-phenylbutanamide (PubChem CID 93128807) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is (2R)-N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 93128807 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | (2R)-N-[[2-(dimethylamino)-5-[(2-methoxyacetyl)amino]phenyl]methyl]-N-[[(2R)-oxolan-2-yl]methyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)N(Cc1cc(NC(=O)COC)ccc1N(C)C)C[C@H]1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O4/c1-5-24(20-10-7-6-8-11-20)27(32)30(18-23-12-9-15-34-23)17-21-16-22(28-26(31)19-33-4)13-14-25(21)29(2)3/h6-8,10-11,13-14,16,23-24H,5,9,12,15,17-19H2,1-4H3,(H,28,31)/t23-,24-/m1/s1 |
| InChIKey | ZJHKSAVXCMREKA-DNQXCXABSA-N |
| XLogP | 4.04 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|