C26H36N4O2 — CID 93129513
(2R)-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-2-phenylbutanamide (PubChem CID 93129513) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (2R)-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 93129513 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2R)-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]-2-phenylbutanamide |
| SMILES | CCNC(=O)Nc1ccc(N(C)C)c(CN(CC2CC2)C(=O)[C@H](CC)c2ccccc2)c1 |
| InChI | InChI=1S/C26H36N4O2/c1-5-23(20-10-8-7-9-11-20)25(31)30(17-19-12-13-19)18-21-16-22(28-26(32)27-6-2)14-15-24(21)29(3)4/h7-11,14-16,19,23H,5-6,12-13,17-18H2,1-4H3,(H2,27,28,32)/t23-/m1/s1 |
| InChIKey | QXYOKHNYOQCFND-HSZRJFAPSA-N |
| XLogP | 4.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|