C19H32N4O2 — CID 24718395
N-butan-2-yl-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]propanamide (PubChem CID 24718395) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-butan-2-yl-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]propanamide.
| Compound Name | N-butan-2-yl-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 24718395 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | N-butan-2-yl-N-[[2-(dimethylamino)-5-(ethylcarbamoylamino)phenyl]methyl]propanamide |
| SMILES | CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)CC)C(C)CC)c1 |
| InChI | InChI=1S/C19H32N4O2/c1-7-14(4)23(18(24)8-2)13-15-12-16(21-19(25)20-9-3)10-11-17(15)22(5)6/h10-12,14H,7-9,13H2,1-6H3,(H2,20,21,25) |
| InChIKey | AAXXCFNGOYFTDA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|