C22H31FN4O3S — CID 42816891
1-[4-(dimethylamino)-3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl]-3-ethylurea (PubChem CID 42816891) has the molecular formula C22H31FN4O3S and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-(dimethylamino)-3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 42816891 |
| Molecular Formula | C22H31FN4O3S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-[4-(dimethylamino)-3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(N(C)C)c(CN(CC(C)C)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H31FN4O3S/c1-6-24-22(28)25-19-9-12-21(26(4)5)17(13-19)15-27(14-16(2)3)31(29,30)20-10-7-18(23)8-11-20/h7-13,16H,6,14-15H2,1-5H3,(H2,24,25,28) |
| InChIKey | RVYDAHJGAJZQKT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|