C25H36FN3O3S — CID 93129119
N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide (PubChem CID 93129119) has the molecular formula C25H36FN3O3S and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 93129119 |
| Molecular Formula | C25H36FN3O3S |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC[C@H](C)N(Cc1cc(NC(=O)CC(C)(C)C)ccc1N(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H36FN3O3S/c1-8-18(2)29(33(31,32)22-12-9-20(26)10-13-22)17-19-15-21(11-14-23(19)28(6)7)27-24(30)16-25(3,4)5/h9-15,18H,8,16-17H2,1-7H3,(H,27,30)/t18-/m0/s1 |
| InChIKey | BKYWUWMAGITLEM-SFHVURJKSA-N |
| XLogP | 5.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|