C24H32FN3O3S — CID 42817301
N-[3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]cyclobutanecarboxamide (PubChem CID 42817301) has the molecular formula C24H32FN3O3S and a molecular weight of 461.60 g/mol. Its IUPAC name is N-[3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 42817301 |
| Molecular Formula | C24H32FN3O3S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[3-[[butan-2-yl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]cyclobutanecarboxamide |
| SMILES | CCC(C)N(Cc1cc(NC(=O)C2CCC2)ccc1N(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O3S/c1-5-17(2)28(32(30,31)22-12-9-20(25)10-13-22)16-19-15-21(11-14-23(19)27(3)4)26-24(29)18-7-6-8-18/h9-15,17-18H,5-8,16H2,1-4H3,(H,26,29) |
| InChIKey | MNOGSPBATSWXHP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|