C23H32FN3O3S — CID 93129109
N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide (PubChem CID 93129109) has the molecular formula C23H32FN3O3S and a molecular weight of 449.59 g/mol. Its IUPAC name is N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 93129109 |
| Molecular Formula | C23H32FN3O3S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[3-[[[(2S)-butan-2-yl]-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methylpropanamide |
| SMILES | CC[C@H](C)N(Cc1cc(NC(=O)C(C)C)ccc1N(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H32FN3O3S/c1-7-17(4)27(31(29,30)21-11-8-19(24)9-12-21)15-18-14-20(25-23(28)16(2)3)10-13-22(18)26(5)6/h8-14,16-17H,7,15H2,1-6H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | MKMAVHZZARLHAI-KRWDZBQOSA-N |
| XLogP | 4.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|