C27H32FN3O3S — CID 46138393
N-[3-[[benzyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide (PubChem CID 46138393) has the molecular formula C27H32FN3O3S and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[3-[[benzyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[benzyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 46138393 |
| Molecular Formula | C27H32FN3O3S |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[3-[[benzyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(N(C)C)c(CN(Cc2ccccc2)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H32FN3O3S/c1-20(2)16-27(32)29-24-12-15-26(30(3)4)22(17-24)19-31(18-21-8-6-5-7-9-21)35(33,34)25-13-10-23(28)11-14-25/h5-15,17,20H,16,18-19H2,1-4H3,(H,29,32) |
| InChIKey | ANURASCLARAQJJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|