C27H31F2N3O3S — CID 46138766
N-[4-(dimethylamino)-3-[[(4-fluorophenyl)methyl-(4-fluorophenyl)sulfonylamino]methyl]phenyl]-3-methylbutanamide (PubChem CID 46138766) has the molecular formula C27H31F2N3O3S and a molecular weight of 515.63 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[(4-fluorophenyl)methyl-(4-fluorophenyl)sulfonylamino]methyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-(dimethylamino)-3-[[(4-fluorophenyl)methyl-(4-fluorophenyl)sulfonylamino]methyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 46138766 |
| Molecular Formula | C27H31F2N3O3S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[(4-fluorophenyl)methyl-(4-fluorophenyl)sulfonylamino]methyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(N(C)C)c(CN(Cc2ccc(F)cc2)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H31F2N3O3S/c1-19(2)15-27(33)30-24-11-14-26(31(3)4)21(16-24)18-32(17-20-5-7-22(28)8-6-20)36(34,35)25-12-9-23(29)10-13-25/h5-14,16,19H,15,17-18H2,1-4H3,(H,30,33) |
| InChIKey | ZUPMYKZUYOPKLV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|