C22H28FN3O4S — CID 42817455
N-[3-[[cyclopropylmethyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methoxyacetamide (PubChem CID 42817455) has the molecular formula C22H28FN3O4S and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[3-[[cyclopropylmethyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methoxyacetamide.
| Compound Name | N-[3-[[cyclopropylmethyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 42817455 |
| Molecular Formula | C22H28FN3O4S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[3-[[cyclopropylmethyl-(4-fluorophenyl)sulfonylamino]methyl]-4-(dimethylamino)phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(N(C)C)c(CN(CC2CC2)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H28FN3O4S/c1-25(2)21-11-8-19(24-22(27)15-30-3)12-17(21)14-26(13-16-4-5-16)31(28,29)20-9-6-18(23)7-10-20/h6-12,16H,4-5,13-15H2,1-3H3,(H,24,27) |
| InChIKey | MJAIMMRPMGYKAX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|