C18H27N3O3S — CID 42817570
N-[3-[[cyclopropylmethyl(methylsulfonyl)amino]methyl]-4-(dimethylamino)phenyl]cyclopropanecarboxamide (PubChem CID 42817570) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[3-[[cyclopropylmethyl(methylsulfonyl)amino]methyl]-4-(dimethylamino)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[cyclopropylmethyl(methylsulfonyl)amino]methyl]-4-(dimethylamino)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42817570 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[3-[[cyclopropylmethyl(methylsulfonyl)amino]methyl]-4-(dimethylamino)phenyl]cyclopropanecarboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CC2)cc1CN(CC1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H27N3O3S/c1-20(2)17-9-8-16(19-18(22)14-6-7-14)10-15(17)12-21(25(3,23)24)11-13-4-5-13/h8-10,13-14H,4-7,11-12H2,1-3H3,(H,19,22) |
| InChIKey | PUMWYSITQJLWFY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|