C27H36ClN3O2 — CID 93128603
2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide (PubChem CID 93128603) has the molecular formula C27H36ClN3O2 and a molecular weight of 470.06 g/mol. Its IUPAC name is 2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 93128603 |
| Molecular Formula | C27H36ClN3O2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](C)N(Cc1cc(NC(=O)C2CCCC2)ccc1N(C)C)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C27H36ClN3O2/c1-18(2)19(3)31(27(33)23-12-8-9-13-24(23)28)17-21-16-22(14-15-25(21)30(4)5)29-26(32)20-10-6-7-11-20/h8-9,12-16,18-20H,6-7,10-11,17H2,1-5H3,(H,29,32)/t19-/m0/s1 |
| InChIKey | RHKYXEVKFVDLDR-IBGZPJMESA-N |
| XLogP | 6.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|