C21H30FN3O4S2 — CID 83283202
N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-4-fluoro-N-propylbenzenesulfonamide (PubChem CID 83283202) has the molecular formula C21H30FN3O4S2 and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-4-fluoro-N-propylbenzenesulfonamide.
| Compound Name | N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-4-fluoro-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 83283202 |
| Molecular Formula | C21H30FN3O4S2 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-4-fluoro-N-propylbenzenesulfonamide |
| SMILES | CCCN(Cc1cc(NS(=O)(=O)CCC)ccc1N(C)C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H30FN3O4S2/c1-5-13-25(31(28,29)20-10-7-18(22)8-11-20)16-17-15-19(9-12-21(17)24(3)4)23-30(26,27)14-6-2/h7-12,15,23H,5-6,13-14,16H2,1-4H3 |
| InChIKey | HFJXNDJTWYRANH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|