C25H28ClN3O2S — CID 93128947
N-[(2S)-butan-2-yl]-N-[[5-[(2-chlorobenzoyl)amino]-2-(dimethylamino)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 93128947) has the molecular formula C25H28ClN3O2S and a molecular weight of 470.04 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-[[5-[(2-chlorobenzoyl)amino]-2-(dimethylamino)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N-[[5-[(2-chlorobenzoyl)amino]-2-(dimethylamino)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 93128947 |
| Molecular Formula | C25H28ClN3O2S |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-[[5-[(2-chlorobenzoyl)amino]-2-(dimethylamino)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CC[C@H](C)N(Cc1cc(NC(=O)c2ccccc2Cl)ccc1N(C)C)C(=O)c1cccs1 |
| InChI | InChI=1S/C25H28ClN3O2S/c1-5-17(2)29(25(31)23-11-8-14-32-23)16-18-15-19(12-13-22(18)28(3)4)27-24(30)20-9-6-7-10-21(20)26/h6-15,17H,5,16H2,1-4H3,(H,27,30)/t17-/m0/s1 |
| InChIKey | JFOLMINZGNPMTN-KRWDZBQOSA-N |
| XLogP | 6.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|