C28H32ClN3O3 — CID 93128214
N-[3-[[[(2S)-butan-2-yl]-(4-methoxybenzoyl)amino]methyl]-4-(dimethylamino)phenyl]-2-chlorobenzamide (PubChem CID 93128214) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is N-[3-[[[(2S)-butan-2-yl]-(4-methoxybenzoyl)amino]methyl]-4-(dimethylamino)phenyl]-2-chlorobenzamide.
| Compound Name | N-[3-[[[(2S)-butan-2-yl]-(4-methoxybenzoyl)amino]methyl]-4-(dimethylamino)phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 93128214 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-[3-[[[(2S)-butan-2-yl]-(4-methoxybenzoyl)amino]methyl]-4-(dimethylamino)phenyl]-2-chlorobenzamide |
| SMILES | CC[C@H](C)N(Cc1cc(NC(=O)c2ccccc2Cl)ccc1N(C)C)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H32ClN3O3/c1-6-19(2)32(28(34)20-11-14-23(35-5)15-12-20)18-21-17-22(13-16-26(21)31(3)4)30-27(33)24-9-7-8-10-25(24)29/h7-17,19H,6,18H2,1-5H3,(H,30,33)/t19-/m0/s1 |
| InChIKey | IOQXAVUQHGVKDL-IBGZPJMESA-N |
| XLogP | 6.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|