C29H32ClN3O2 — CID 93128986
2-chloro-N-[3-[[cyclopropyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]benzamide (PubChem CID 93128986) has the molecular formula C29H32ClN3O2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 2-chloro-N-[3-[[cyclopropyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[[cyclopropyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 93128986 |
| Molecular Formula | C29H32ClN3O2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-chloro-N-[3-[[cyclopropyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]benzamide |
| SMILES | CC[C@H](C(=O)N(Cc1cc(NC(=O)c2ccccc2Cl)ccc1N(C)C)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C29H32ClN3O2/c1-4-24(20-10-6-5-7-11-20)29(35)33(23-15-16-23)19-21-18-22(14-17-27(21)32(2)3)31-28(34)25-12-8-9-13-26(25)30/h5-14,17-18,23-24H,4,15-16,19H2,1-3H3,(H,31,34)/t24-/m0/s1 |
| InChIKey | LXHIANJPDFAUCZ-DEOSSOPVSA-N |
| XLogP | 6.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|