C28H39N3O2 — CID 93129464
N-[3-[[cyclopropylmethyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide (PubChem CID 93129464) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[3-[[cyclopropylmethyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[[cyclopropylmethyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 93129464 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | N-[3-[[cyclopropylmethyl-[(2S)-2-phenylbutanoyl]amino]methyl]-4-(dimethylamino)phenyl]-3-methylbutanamide |
| SMILES | CC[C@H](C(=O)N(Cc1cc(NC(=O)CC(C)C)ccc1N(C)C)CC1CC1)c1ccccc1 |
| InChI | InChI=1S/C28H39N3O2/c1-6-25(22-10-8-7-9-11-22)28(33)31(18-21-12-13-21)19-23-17-24(14-15-26(23)30(4)5)29-27(32)16-20(2)3/h7-11,14-15,17,20-21,25H,6,12-13,16,18-19H2,1-5H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | SPHLZEGKAVYGLW-VWLOTQADSA-N |
| XLogP | 5.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|