C26H39N3O4S — CID 93129099
N-[(2S)-butan-2-yl]-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]-2-ethylbutanamide (PubChem CID 93129099) has the molecular formula C26H39N3O4S and a molecular weight of 489.68 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]-2-ethylbutanamide.
| Compound Name | N-[(2S)-butan-2-yl]-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 93129099 |
| Molecular Formula | C26H39N3O4S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)N(Cc1cc(NS(=O)(=O)c2ccc(OC)cc2)ccc1N(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C26H39N3O4S/c1-8-19(4)29(26(30)20(9-2)10-3)18-21-17-22(11-16-25(21)28(5)6)27-34(31,32)24-14-12-23(33-7)13-15-24/h11-17,19-20,27H,8-10,18H2,1-7H3/t19-/m0/s1 |
| InChIKey | KBRFZZWCOJVLOG-IBGZPJMESA-N |
| XLogP | 5.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|