C27H30ClN3O4S — CID 24719176
2-chloro-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]benzamide (PubChem CID 24719176) has the molecular formula C27H30ClN3O4S and a molecular weight of 528.07 g/mol. Its IUPAC name is 2-chloro-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]benzamide.
| Compound Name | 2-chloro-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 24719176 |
| Molecular Formula | C27H30ClN3O4S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-chloro-N-(cyclopropylmethyl)-N-[[2-(dimethylamino)-5-[(4-methoxyphenyl)sulfonylamino]phenyl]methyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N(C)C)c(CN(CC3CC3)C(=O)c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C27H30ClN3O4S/c1-30(2)26-15-10-21(29-36(33,34)23-13-11-22(35-3)12-14-23)16-20(26)18-31(17-19-8-9-19)27(32)24-6-4-5-7-25(24)28/h4-7,10-16,19,29H,8-9,17-18H2,1-3H3 |
| InChIKey | LDLCREUSRXZCBM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|