C18H22ClNO4S2 — CID 93143055
[2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] ethanesulfonate (PubChem CID 93143055) has the molecular formula C18H22ClNO4S2 and a molecular weight of 415.96 g/mol. Its IUPAC name is [2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] ethanesulfonate.
| Compound Name | [2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] ethanesulfonate |
|---|---|
| PubChem CID | 93143055 |
| Molecular Formula | C18H22ClNO4S2 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [2-[[[(2S)-butan-2-yl]-(thiophene-2-carbonyl)amino]methyl]-4-chlorophenyl] ethanesulfonate |
| SMILES | CC[C@H](C)N(Cc1cc(Cl)ccc1OS(=O)(=O)CC)C(=O)c1cccs1 |
| InChI | InChI=1S/C18H22ClNO4S2/c1-4-13(3)20(18(21)17-7-6-10-25-17)12-14-11-15(19)8-9-16(14)24-26(22,23)5-2/h6-11,13H,4-5,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | KJCZFICFXRVBDA-ZDUSSCGKSA-N |
| XLogP | 4.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|