C18H22ClNO5S — CID 42812115
[4-chloro-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 42812115) has the molecular formula C18H22ClNO5S and a molecular weight of 399.90 g/mol. Its IUPAC name is [4-chloro-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-chloro-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 42812115 |
| Molecular Formula | C18H22ClNO5S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [4-chloro-2-[[furan-2-carbonyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(Cl)cc1CN(CC(C)C)C(=O)c1ccco1 |
| InChI | InChI=1S/C18H22ClNO5S/c1-4-26(22,23)25-16-8-7-15(19)10-14(16)12-20(11-13(2)3)18(21)17-6-5-9-24-17/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | BXOFZKAXIUHKIS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|