C22H29NO6S — CID 5101950
[2-methoxy-5-[[(3-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 5101950) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is [2-methoxy-5-[[(3-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [2-methoxy-5-[[(3-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 5101950 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [2-methoxy-5-[[(3-methoxybenzoyl)-(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cc(CN(CC(C)C)C(=O)c2cccc(OC)c2)ccc1OC |
| InChI | InChI=1S/C22H29NO6S/c1-6-30(25,26)29-21-12-17(10-11-20(21)28-5)15-23(14-16(2)3)22(24)18-8-7-9-19(13-18)27-4/h7-13,16H,6,14-15H2,1-5H3 |
| InChIKey | GQANFNXWEGWTPW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|