C26H29NO3 — CID 42725516
3-methoxy-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 42725516) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-methoxy-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 3-methoxy-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42725516 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 3-methoxy-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | COc1cccc(C(=O)N(Cc2cccc(OCc3ccccc3)c2)CC(C)C)c1 |
| InChI | InChI=1S/C26H29NO3/c1-20(2)17-27(26(28)23-12-8-13-24(16-23)29-3)18-22-11-7-14-25(15-22)30-19-21-9-5-4-6-10-21/h4-16,20H,17-19H2,1-3H3 |
| InChIKey | XWNUICZBYMSNBB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |