C26H37NO2 — CID 42725504
N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]octanamide (PubChem CID 42725504) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]octanamide.
| Compound Name | N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]octanamide |
|---|---|
| PubChem CID | 42725504 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]octanamide |
| SMILES | CCCCCCCC(=O)N(Cc1cccc(OCc2ccccc2)c1)CC(C)C |
| InChI | InChI=1S/C26H37NO2/c1-4-5-6-7-11-17-26(28)27(19-22(2)3)20-24-15-12-16-25(18-24)29-21-23-13-9-8-10-14-23/h8-10,12-16,18,22H,4-7,11,17,19-21H2,1-3H3 |
| InChIKey | QZMBZHFQUNSRKD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|