C21H27NO4S — CID 4197526
[3-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4197526) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is [3-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4197526 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [3-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(CC(C)C)C(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H27NO4S/c1-4-27(24,25)26-20-12-8-11-19(13-20)16-22(15-17(2)3)21(23)14-18-9-6-5-7-10-18/h5-13,17H,4,14-16H2,1-3H3 |
| InChIKey | HYVUMGAGQICBCX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|