C26H26F3NO4S — CID 3937045
[4-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3937045) has the molecular formula C26H26F3NO4S and a molecular weight of 505.56 g/mol. Its IUPAC name is [4-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3937045 |
| Molecular Formula | C26H26F3NO4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | [4-[[2-methylpropyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H26F3NO4S/c1-19(2)17-30(25(31)15-20-7-4-3-5-8-20)18-21-11-13-23(14-12-21)34-35(32,33)24-10-6-9-22(16-24)26(27,28)29/h3-14,16,19H,15,17-18H2,1-2H3 |
| InChIKey | CYGKFIDHMDBFKJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|