C26H25F4NO4S — CID 3660114
[4-[[[2-(4-fluorophenyl)acetyl]-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3660114) has the molecular formula C26H25F4NO4S and a molecular weight of 523.55 g/mol. Its IUPAC name is [4-[[[2-(4-fluorophenyl)acetyl]-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[[2-(4-fluorophenyl)acetyl]-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3660114 |
| Molecular Formula | C26H25F4NO4S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | [4-[[[2-(4-fluorophenyl)acetyl]-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H25F4NO4S/c1-18(2)16-31(25(32)14-19-6-10-22(27)11-7-19)17-20-8-12-23(13-9-20)35-36(33,34)24-5-3-4-21(15-24)26(28,29)30/h3-13,15,18H,14,16-17H2,1-2H3 |
| InChIKey | VLECHOVBSPYHBX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|