C27H22F3NO5S — CID 4084644
[4-[[furan-2-ylmethyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4084644) has the molecular formula C27H22F3NO5S and a molecular weight of 529.54 g/mol. Its IUPAC name is [4-[[furan-2-ylmethyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[furan-2-ylmethyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4084644 |
| Molecular Formula | C27H22F3NO5S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | [4-[[furan-2-ylmethyl-(2-phenylacetyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Cc1ccccc1)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C27H22F3NO5S/c28-27(29,30)22-8-4-10-25(17-22)37(33,34)36-23-13-11-21(12-14-23)18-31(19-24-9-5-15-35-24)26(32)16-20-6-2-1-3-7-20/h1-15,17H,16,18-19H2 |
| InChIKey | GLZKMXGVSYPBRT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|