C26H20ClF3N2O5S — CID 4163172
[4-[[(4-chlorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4163172) has the molecular formula C26H20ClF3N2O5S and a molecular weight of 564.97 g/mol. Its IUPAC name is [4-[[(4-chlorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[(4-chlorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4163172 |
| Molecular Formula | C26H20ClF3N2O5S |
| Molecular Weight | 564.97 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | [4-[[(4-chlorophenyl)carbamoyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Nc1ccc(Cl)cc1)N(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C26H20ClF3N2O5S/c27-20-8-10-21(11-9-20)31-25(33)32(17-23-4-2-14-36-23)16-18-6-12-22(13-7-18)37-38(34,35)24-5-1-3-19(15-24)26(28,29)30/h1-15H,16-17H2,(H,31,33) |
| InChIKey | FKLGJBNGPIARTJ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.97 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|