C25H19ClF3NO6S2 — CID 4196487
[3-[[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4196487) has the molecular formula C25H19ClF3NO6S2 and a molecular weight of 586.01 g/mol. Its IUPAC name is [3-[[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4196487 |
| Molecular Formula | C25H19ClF3NO6S2 |
| Molecular Weight | 586.01 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | [3-[[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(Oc1cccc(CN(Cc2ccco2)S(=O)(=O)c2ccc(Cl)cc2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H19ClF3NO6S2/c26-20-9-11-23(12-10-20)37(31,32)30(17-22-7-3-13-35-22)16-18-4-1-6-21(14-18)36-38(33,34)24-8-2-5-19(15-24)25(27,28)29/h1-15H,16-17H2 |
| InChIKey | NCOOIHAIXPWZAM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|